C10H10BrF2N3O2 — CID 171484721
5-bromo-3-(4,4-difluoropiperidin-1-yl)-2-nitropyridine (PubChem CID 171484721) has the molecular formula C10H10BrF2N3O2 and a molecular weight of 322.11 g/mol. Its IUPAC name is 5-bromo-3-(4,4-difluoropiperidin-1-yl)-2-nitropyridine.
| Compound Name | 5-bromo-3-(4,4-difluoropiperidin-1-yl)-2-nitropyridine |
|---|---|
| PubChem CID | 171484721 |
| Molecular Formula | C10H10BrF2N3O2 |
| Molecular Weight | 322.11 g/mol |
| Exact Mass | 320.99 |
| IUPAC Name | 5-bromo-3-(4,4-difluoropiperidin-1-yl)-2-nitropyridine |
| SMILES | O=[N+]([O-])c1ncc(Br)cc1N1CCC(F)(F)CC1 |
| InChI | InChI=1S/C10H10BrF2N3O2/c11-7-5-8(9(14-6-7)16(17)18)15-3-1-10(12,13)2-4-15/h5-6H,1-4H2 |
| InChIKey | XXDXZRWOWBFTKV-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 59.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.11 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|