C18H10F6N2O4 — CID 171485355
(2,3,4,5,6-pentafluorophenyl) 5-(2,4-dioxo-1,3-diazinan-1-yl)-2-fluoro-4-methylbenzoate (PubChem CID 171485355) has the molecular formula C18H10F6N2O4 and a molecular weight of 432.28 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 5-(2,4-dioxo-1,3-diazinan-1-yl)-2-fluoro-4-methylbenzoate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 5-(2,4-dioxo-1,3-diazinan-1-yl)-2-fluoro-4-methylbenzoate |
|---|---|
| PubChem CID | 171485355 |
| Molecular Formula | C18H10F6N2O4 |
| Molecular Weight | 432.28 g/mol |
| Exact Mass | 432.05 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 5-(2,4-dioxo-1,3-diazinan-1-yl)-2-fluoro-4-methylbenzoate |
| SMILES | Cc1cc(F)c(C(=O)Oc2c(F)c(F)c(F)c(F)c2F)cc1N1CCC(=O)NC1=O |
| InChI | InChI=1S/C18H10F6N2O4/c1-6-4-8(19)7(5-9(6)26-3-2-10(27)25-18(26)29)17(28)30-16-14(23)12(21)11(20)13(22)15(16)24/h4-5H,2-3H2,1H3,(H,25,27,29) |
| InChIKey | OWNSWFVTDYJEGF-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.28 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|