C24H30ClN5O3 — CID 171485379
1-[2-chloro-5-[4-(4-piperazin-1-ylbut-1-ynyl)piperidine-1-carbonyl]phenyl]-1,3-diazinane-2,4-dione (PubChem CID 171485379) has the molecular formula C24H30ClN5O3 and a molecular weight of 471.99 g/mol. Its IUPAC name is 1-[2-chloro-5-[4-(4-piperazin-1-ylbut-1-ynyl)piperidine-1-carbonyl]phenyl]-1,3-diazinane-2,4-dione.
| Compound Name | 1-[2-chloro-5-[4-(4-piperazin-1-ylbut-1-ynyl)piperidine-1-carbonyl]phenyl]-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 171485379 |
| Molecular Formula | C24H30ClN5O3 |
| Molecular Weight | 471.99 g/mol |
| Exact Mass | 471.20 |
| IUPAC Name | 1-[2-chloro-5-[4-(4-piperazin-1-ylbut-1-ynyl)piperidine-1-carbonyl]phenyl]-1,3-diazinane-2,4-dione |
| SMILES | O=C1CCN(c2cc(C(=O)N3CCC(C#CCCN4CCNCC4)CC3)ccc2Cl)C(=O)N1 |
| InChI | InChI=1S/C24H30ClN5O3/c25-20-5-4-19(17-21(20)30-14-8-22(31)27-24(30)33)23(32)29-12-6-18(7-13-29)3-1-2-11-28-15-9-26-10-16-28/h4-5,17-18,26H,2,6-16H2,(H,27,31,33) |
| InChIKey | CGMIORYZODJWSS-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 84.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.99 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|