C14H21BFN3O2 — CID 171485589
2-[(3R)-3-fluoropyrrolidin-1-yl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazine (PubChem CID 171485589) has the molecular formula C14H21BFN3O2 and a molecular weight of 293.15 g/mol. Its IUPAC name is 2-[(3R)-3-fluoropyrrolidin-1-yl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazine.
| Compound Name | 2-[(3R)-3-fluoropyrrolidin-1-yl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazine |
|---|---|
| PubChem CID | 171485589 |
| Molecular Formula | C14H21BFN3O2 |
| Molecular Weight | 293.15 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | 2-[(3R)-3-fluoropyrrolidin-1-yl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazine |
| SMILES | CC1(C)OB(c2cnc(N3CC[C@@H](F)C3)cn2)OC1(C)C |
| InChI | InChI=1S/C14H21BFN3O2/c1-13(2)14(3,4)21-15(20-13)11-7-18-12(8-17-11)19-6-5-10(16)9-19/h7-8,10H,5-6,9H2,1-4H3/t10-/m1/s1 |
| InChIKey | KXPKUIDYGHYHGJ-SNVBAGLBSA-N |
| XLogP | 1.32 |
| TPSA | 47.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.15 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|