C14H18ClN5O3 — CID 17148592
2-(7,8-dimethoxy-1-oxo-10,10a-dihydro-5H-imidazo[1,5-b]isoquinolin-3-yl)guanidine;hydrochloride (PubChem CID 17148592) has the molecular formula C14H18ClN5O3 and a molecular weight of 339.78 g/mol. Its IUPAC name is 2-(7,8-dimethoxy-1-oxo-10,10a-dihydro-5H-imidazo[1,5-b]isoquinolin-3-yl)guanidine;hydrochloride.
| Compound Name | 2-(7,8-dimethoxy-1-oxo-10,10a-dihydro-5H-imidazo[1,5-b]isoquinolin-3-yl)guanidine;hydrochloride |
|---|---|
| PubChem CID | 17148592 |
| Molecular Formula | C14H18ClN5O3 |
| Molecular Weight | 339.78 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | 2-(7,8-dimethoxy-1-oxo-10,10a-dihydro-5H-imidazo[1,5-b]isoquinolin-3-yl)guanidine;hydrochloride |
| SMILES | COc1cc2c(cc1OC)CN1C(N=C(N)N)=NC(=O)C1C2.Cl |
| InChI | InChI=1S/C14H17N5O3.ClH/c1-21-10-4-7-3-9-12(20)17-14(18-13(15)16)19(9)6-8(7)5-11(10)22-2;/h4-5,9H,3,6H2,1-2H3,(H4,15,16,17,18,20);1H |
| InChIKey | DPFBWMXCPYQQAO-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 115.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.78 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|