About CID 171486103
CID 171486103 (PubChem CID 171486103) has the molecular formula C18H37O2SSi
and a molecular weight of 345.65 g/mol.
Molecular Properties
| Compound Name | CID 171486103 |
| PubChem CID | 171486103 |
| Molecular Formula | C18H37O2SSi |
| Molecular Weight | 345.65 g/mol |
| Exact Mass | 345.23 |
| IUPAC Name | — |
| SMILES | CCCCCCC(=O)SCCCC(C)O[Si](CCC)CCC |
| InChI | InChI=1S/C18H37O2SSi/c1-5-8-9-10-13-18(19)21-14-11-12-17(4)20-22(15-6-2)16-7-3/h17H,5-16H2,1-4H3 |
| InChIKey | XSYCTDQAANQLST-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 345.65 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze CID 171486103 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 171486103?
The IUPAC name of CID 171486103 (CID 171486103) is not available.
What is the SMILES notation for CID 171486103?
The canonical SMILES for CID 171486103 is CCCCCCC(=O)SCCCC(C)O[Si](CCC)CCC.
What is the InChIKey of CID 171486103?
The InChIKey is XSYCTDQAANQLST-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H37O2SSi/c1-5-8-9-10-13-18(19)21-14-11-12-17(4)20-22(15-6-2)16-7-3/h17H,5-16H2,1-4H3.
What are the key properties of CID 171486103?
CID 171486103 has a molecular weight of 345.65 g/mol, XLogP of 6.21, 15 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 171486103 is sourced from PubChem (CID 171486103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).