C12H9BrFN3S — CID 171486879
6-bromo-2-(2,5-dimethylpyrrol-1-yl)-5-fluoro-[1,3]thiazolo[4,5-b]pyridine (PubChem CID 171486879) has the molecular formula C12H9BrFN3S and a molecular weight of 326.19 g/mol. Its IUPAC name is 6-bromo-2-(2,5-dimethylpyrrol-1-yl)-5-fluoro-[1,3]thiazolo[4,5-b]pyridine.
| Compound Name | 6-bromo-2-(2,5-dimethylpyrrol-1-yl)-5-fluoro-[1,3]thiazolo[4,5-b]pyridine |
|---|---|
| PubChem CID | 171486879 |
| Molecular Formula | C12H9BrFN3S |
| Molecular Weight | 326.19 g/mol |
| Exact Mass | 324.97 |
| IUPAC Name | 6-bromo-2-(2,5-dimethylpyrrol-1-yl)-5-fluoro-[1,3]thiazolo[4,5-b]pyridine |
| SMILES | Cc1ccc(C)n1-c1nc2nc(F)c(Br)cc2s1 |
| InChI | InChI=1S/C12H9BrFN3S/c1-6-3-4-7(2)17(6)12-16-11-9(18-12)5-8(13)10(14)15-11/h3-5H,1-2H3 |
| InChIKey | LGMLOKGOPNQQLH-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.19 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|