About 5-fluoro-[1,3]thiazolo[4,5-b]pyridine
5-fluoro-[1,3]thiazolo[4,5-b]pyridine (PubChem CID 171486916) has the molecular formula C6H3FN2S
and a molecular weight of 154.17 g/mol. Its IUPAC name is 5-fluoro-[1,3]thiazolo[4,5-b]pyridine.
Molecular Properties
| Compound Name | 5-fluoro-[1,3]thiazolo[4,5-b]pyridine |
| PubChem CID | 171486916 |
| Molecular Formula | C6H3FN2S |
| Molecular Weight | 154.17 g/mol |
| Exact Mass | 154.00 |
| IUPAC Name | 5-fluoro-[1,3]thiazolo[4,5-b]pyridine |
| SMILES | Fc1ccc2scnc2n1 |
| InChI | InChI=1S/C6H3FN2S/c7-5-2-1-4-6(9-5)8-3-10-4/h1-3H |
| InChIKey | DLDXYDVVAKUYED-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.17 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 5-fluoro-[1,3]thiazolo[4,5-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-[1,3]thiazolo[4,5-b]pyridine?
The IUPAC name of 5-fluoro-[1,3]thiazolo[4,5-b]pyridine (CID 171486916) is 5-fluoro-[1,3]thiazolo[4,5-b]pyridine.
What is the SMILES notation for 5-fluoro-[1,3]thiazolo[4,5-b]pyridine?
The canonical SMILES for 5-fluoro-[1,3]thiazolo[4,5-b]pyridine is Fc1ccc2scnc2n1.
What is the InChIKey of 5-fluoro-[1,3]thiazolo[4,5-b]pyridine?
The InChIKey is DLDXYDVVAKUYED-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3FN2S/c7-5-2-1-4-6(9-5)8-3-10-4/h1-3H.
What are the key properties of 5-fluoro-[1,3]thiazolo[4,5-b]pyridine?
5-fluoro-[1,3]thiazolo[4,5-b]pyridine has a molecular weight of 154.17 g/mol, XLogP of 1.83, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-[1,3]thiazolo[4,5-b]pyridine is sourced from PubChem (CID 171486916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).