About (S)-N-(2,6-dimethylphenyl)-4-phenylbenzenesulfinamide
(S)-N-(2,6-dimethylphenyl)-4-phenylbenzenesulfinamide (PubChem CID 171487084) has the molecular formula C20H19NOS
and a molecular weight of 321.45 g/mol. Its IUPAC name is (S)-N-(2,6-dimethylphenyl)-4-phenylbenzenesulfinamide.
Molecular Properties
| Compound Name | (S)-N-(2,6-dimethylphenyl)-4-phenylbenzenesulfinamide |
| PubChem CID | 171487084 |
| Molecular Formula | C20H19NOS |
| Molecular Weight | 321.45 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | (S)-N-(2,6-dimethylphenyl)-4-phenylbenzenesulfinamide |
| SMILES | Cc1cccc(C)c1N[S@@](=O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C20H19NOS/c1-15-7-6-8-16(2)20(15)21-23(22)19-13-11-18(12-14-19)17-9-4-3-5-10-17/h3-14,21H,1-2H3/t23-/m0/s1 |
| InChIKey | SBUZXCCSFMTFBP-QHCPKHFHSA-N |
| XLogP | 5.11 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 321.45 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (S)-N-(2,6-dimethylphenyl)-4-phenylbenzenesulfinamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (S)-N-(2,6-dimethylphenyl)-4-phenylbenzenesulfinamide?
The IUPAC name of (S)-N-(2,6-dimethylphenyl)-4-phenylbenzenesulfinamide (CID 171487084) is (S)-N-(2,6-dimethylphenyl)-4-phenylbenzenesulfinamide.
What is the SMILES notation for (S)-N-(2,6-dimethylphenyl)-4-phenylbenzenesulfinamide?
The canonical SMILES for (S)-N-(2,6-dimethylphenyl)-4-phenylbenzenesulfinamide is Cc1cccc(C)c1N[S@@](=O)c1ccc(-c2ccccc2)cc1.
What is the InChIKey of (S)-N-(2,6-dimethylphenyl)-4-phenylbenzenesulfinamide?
The InChIKey is SBUZXCCSFMTFBP-QHCPKHFHSA-N. The full InChI is InChI=1S/C20H19NOS/c1-15-7-6-8-16(2)20(15)21-23(22)19-13-11-18(12-14-19)17-9-4-3-5-10-17/h3-14,21H,1-2H3/t23-/m0/s1.
What are the key properties of (S)-N-(2,6-dimethylphenyl)-4-phenylbenzenesulfinamide?
(S)-N-(2,6-dimethylphenyl)-4-phenylbenzenesulfinamide has a molecular weight of 321.45 g/mol, XLogP of 5.11, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (S)-N-(2,6-dimethylphenyl)-4-phenylbenzenesulfinamide is sourced from PubChem (CID 171487084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).