C20H19NOS — CID 171487084
(S)-N-(2,6-dimethylphenyl)-4-phenylbenzenesulfinamide (PubChem CID 171487084) has the molecular formula C20H19NOS and a molecular weight of 321.45 g/mol. Its IUPAC name is (S)-N-(2,6-dimethylphenyl)-4-phenylbenzenesulfinamide.
| Compound Name | (S)-N-(2,6-dimethylphenyl)-4-phenylbenzenesulfinamide |
|---|---|
| PubChem CID | 171487084 |
| Molecular Formula | C20H19NOS |
| Molecular Weight | 321.45 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | (S)-N-(2,6-dimethylphenyl)-4-phenylbenzenesulfinamide |
| SMILES | Cc1cccc(C)c1N[S@@](=O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C20H19NOS/c1-15-7-6-8-16(2)20(15)21-23(22)19-13-11-18(12-14-19)17-9-4-3-5-10-17/h3-14,21H,1-2H3/t23-/m0/s1 |
| InChIKey | SBUZXCCSFMTFBP-QHCPKHFHSA-N |
| XLogP | 5.11 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.45 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |