About 5-[3-(5-bromopentyl)-4,5-bis(4-methoxyphenyl)imidazol-3-ium-1-yl]pentan-1-ol bromide
5-[3-(5-bromopentyl)-4,5-bis(4-methoxyphenyl)imidazol-3-ium-1-yl]pentan-1-ol bromide (PubChem CID 171487194) has the molecular formula C27H36Br2N2O3
and a molecular weight of 596.40 g/mol. Its IUPAC name is 5-[3-(5-bromopentyl)-4,5-bis(4-methoxyphenyl)imidazol-3-ium-1-yl]pentan-1-ol bromide.
Molecular Properties
| Compound Name | 5-[3-(5-bromopentyl)-4,5-bis(4-methoxyphenyl)imidazol-3-ium-1-yl]pentan-1-ol bromide |
| PubChem CID | 171487194 |
| Molecular Formula | C27H36Br2N2O3 |
| Molecular Weight | 596.40 g/mol |
| Exact Mass | 594.11 |
| IUPAC Name | 5-[3-(5-bromopentyl)-4,5-bis(4-methoxyphenyl)imidazol-3-ium-1-yl]pentan-1-ol bromide |
| SMILES | COc1ccc(-c2c(-c3ccc(OC)cc3)[n+](CCCCCBr)cn2CCCCCO)cc1.[Br-] |
| InChI | InChI=1S/C27H36BrN2O3.BrH/c1-32-24-13-9-22(10-14-24)26-27(23-11-15-25(33-2)16-12-23)30(19-7-4-8-20-31)21-29(26)18-6-3-5-17-28;/h9-16,21,31H,3-8,17-20H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | KYPARNISSBDXNA-UHFFFAOYSA-M |
| XLogP | 2.86 |
| TPSA | 47.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 596.40 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 5-[3-(5-bromopentyl)-4,5-bis(4-methoxyphenyl)imidazol-3-ium-1-yl]pentan-1-ol bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[3-(5-bromopentyl)-4,5-bis(4-methoxyphenyl)imidazol-3-ium-1-yl]pentan-1-ol bromide?
The IUPAC name of 5-[3-(5-bromopentyl)-4,5-bis(4-methoxyphenyl)imidazol-3-ium-1-yl]pentan-1-ol bromide (CID 171487194) is 5-[3-(5-bromopentyl)-4,5-bis(4-methoxyphenyl)imidazol-3-ium-1-yl]pentan-1-ol bromide.
What is the SMILES notation for 5-[3-(5-bromopentyl)-4,5-bis(4-methoxyphenyl)imidazol-3-ium-1-yl]pentan-1-ol bromide?
The canonical SMILES for 5-[3-(5-bromopentyl)-4,5-bis(4-methoxyphenyl)imidazol-3-ium-1-yl]pentan-1-ol bromide is COc1ccc(-c2c(-c3ccc(OC)cc3)[n+](CCCCCBr)cn2CCCCCO)cc1.[Br-].
What is the InChIKey of 5-[3-(5-bromopentyl)-4,5-bis(4-methoxyphenyl)imidazol-3-ium-1-yl]pentan-1-ol bromide?
The InChIKey is KYPARNISSBDXNA-UHFFFAOYSA-M. The full InChI is InChI=1S/C27H36BrN2O3.BrH/c1-32-24-13-9-22(10-14-24)26-27(23-11-15-25(33-2)16-12-23)30(19-7-4-8-20-31)21-29(26)18-6-3-5-17-28;/h9-16,21,31H,3-8,17-20H2,1-2H3;1H/q+1;/p-1.
What are the key properties of 5-[3-(5-bromopentyl)-4,5-bis(4-methoxyphenyl)imidazol-3-ium-1-yl]pentan-1-ol bromide?
5-[3-(5-bromopentyl)-4,5-bis(4-methoxyphenyl)imidazol-3-ium-1-yl]pentan-1-ol bromide has a molecular weight of 596.40 g/mol, XLogP of 2.86, 14 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[3-(5-bromopentyl)-4,5-bis(4-methoxyphenyl)imidazol-3-ium-1-yl]pentan-1-ol bromide is sourced from PubChem (CID 171487194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).