About methyl (6S)-6-prop-2-enyl-1,4,8-trioxaspiro[4.5]decane-6-carboxylate
methyl (6S)-6-prop-2-enyl-1,4,8-trioxaspiro[4.5]decane-6-carboxylate (PubChem CID 171487204) has the molecular formula C12H18O5
and a molecular weight of 242.27 g/mol. Its IUPAC name is methyl (6S)-6-prop-2-enyl-1,4,8-trioxaspiro[4.5]decane-6-carboxylate.
Molecular Properties
| Compound Name | methyl (6S)-6-prop-2-enyl-1,4,8-trioxaspiro[4.5]decane-6-carboxylate |
| PubChem CID | 171487204 |
| Molecular Formula | C12H18O5 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | methyl (6S)-6-prop-2-enyl-1,4,8-trioxaspiro[4.5]decane-6-carboxylate |
| SMILES | C=CC[C@]1(C(=O)OC)COCCC12OCCO2 |
| InChI | InChI=1S/C12H18O5/c1-3-4-11(10(13)14-2)9-15-6-5-12(11)16-7-8-17-12/h3H,1,4-9H2,2H3/t11-/m1/s1 |
| InChIKey | WLJZFTGNKLMRKJ-LLVKDONJSA-N |
| XLogP | 0.89 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl (6S)-6-prop-2-enyl-1,4,8-trioxaspiro[4.5]decane-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (6S)-6-prop-2-enyl-1,4,8-trioxaspiro[4.5]decane-6-carboxylate?
The IUPAC name of methyl (6S)-6-prop-2-enyl-1,4,8-trioxaspiro[4.5]decane-6-carboxylate (CID 171487204) is methyl (6S)-6-prop-2-enyl-1,4,8-trioxaspiro[4.5]decane-6-carboxylate.
What is the SMILES notation for methyl (6S)-6-prop-2-enyl-1,4,8-trioxaspiro[4.5]decane-6-carboxylate?
The canonical SMILES for methyl (6S)-6-prop-2-enyl-1,4,8-trioxaspiro[4.5]decane-6-carboxylate is C=CC[C@]1(C(=O)OC)COCCC12OCCO2.
What is the InChIKey of methyl (6S)-6-prop-2-enyl-1,4,8-trioxaspiro[4.5]decane-6-carboxylate?
The InChIKey is WLJZFTGNKLMRKJ-LLVKDONJSA-N. The full InChI is InChI=1S/C12H18O5/c1-3-4-11(10(13)14-2)9-15-6-5-12(11)16-7-8-17-12/h3H,1,4-9H2,2H3/t11-/m1/s1.
What are the key properties of methyl (6S)-6-prop-2-enyl-1,4,8-trioxaspiro[4.5]decane-6-carboxylate?
methyl (6S)-6-prop-2-enyl-1,4,8-trioxaspiro[4.5]decane-6-carboxylate has a molecular weight of 242.27 g/mol, XLogP of 0.89, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (6S)-6-prop-2-enyl-1,4,8-trioxaspiro[4.5]decane-6-carboxylate is sourced from PubChem (CID 171487204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).