About 2,6-bis(4-bromocyclohexa-2,4-dien-1-ylidene)cyclohexan-1-one
2,6-bis(4-bromocyclohexa-2,4-dien-1-ylidene)cyclohexan-1-one (PubChem CID 171487235) has the molecular formula C18H16Br2O
and a molecular weight of 408.13 g/mol. Its IUPAC name is 2,6-bis(4-bromocyclohexa-2,4-dien-1-ylidene)cyclohexan-1-one.
Molecular Properties
| Compound Name | 2,6-bis(4-bromocyclohexa-2,4-dien-1-ylidene)cyclohexan-1-one |
| PubChem CID | 171487235 |
| Molecular Formula | C18H16Br2O |
| Molecular Weight | 408.13 g/mol |
| Exact Mass | 405.96 |
| IUPAC Name | 2,6-bis(4-bromocyclohexa-2,4-dien-1-ylidene)cyclohexan-1-one |
| SMILES | O=C1C(=C2C=CC(Br)=CC2)CCCC1=C1C=CC(Br)=CC1 |
| InChI | InChI=1S/C18H16Br2O/c19-14-8-4-12(5-9-14)16-2-1-3-17(18(16)21)13-6-10-15(20)11-7-13/h4,6,8-11H,1-3,5,7H2 |
| InChIKey | TYHNDOULLTYOIA-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 408.13 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2,6-bis(4-bromocyclohexa-2,4-dien-1-ylidene)cyclohexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-bis(4-bromocyclohexa-2,4-dien-1-ylidene)cyclohexan-1-one?
The IUPAC name of 2,6-bis(4-bromocyclohexa-2,4-dien-1-ylidene)cyclohexan-1-one (CID 171487235) is 2,6-bis(4-bromocyclohexa-2,4-dien-1-ylidene)cyclohexan-1-one.
What is the SMILES notation for 2,6-bis(4-bromocyclohexa-2,4-dien-1-ylidene)cyclohexan-1-one?
The canonical SMILES for 2,6-bis(4-bromocyclohexa-2,4-dien-1-ylidene)cyclohexan-1-one is O=C1C(=C2C=CC(Br)=CC2)CCCC1=C1C=CC(Br)=CC1.
What is the InChIKey of 2,6-bis(4-bromocyclohexa-2,4-dien-1-ylidene)cyclohexan-1-one?
The InChIKey is TYHNDOULLTYOIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16Br2O/c19-14-8-4-12(5-9-14)16-2-1-3-17(18(16)21)13-6-10-15(20)11-7-13/h4,6,8-11H,1-3,5,7H2.
What are the key properties of 2,6-bis(4-bromocyclohexa-2,4-dien-1-ylidene)cyclohexan-1-one?
2,6-bis(4-bromocyclohexa-2,4-dien-1-ylidene)cyclohexan-1-one has a molecular weight of 408.13 g/mol, XLogP of 5.81, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-bis(4-bromocyclohexa-2,4-dien-1-ylidene)cyclohexan-1-one is sourced from PubChem (CID 171487235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).