C47H92O5S2 — CID 171487417
[14-decanoyloxy-1,15-bis(hexylsulfanyl)-8-hydroxypentadecan-2-yl] decanoate (PubChem CID 171487417) has the molecular formula C47H92O5S2 and a molecular weight of 801.38 g/mol. Its IUPAC name is [14-decanoyloxy-1,15-bis(hexylsulfanyl)-8-hydroxypentadecan-2-yl] decanoate.
| Compound Name | [14-decanoyloxy-1,15-bis(hexylsulfanyl)-8-hydroxypentadecan-2-yl] decanoate |
|---|---|
| PubChem CID | 171487417 |
| Molecular Formula | C47H92O5S2 |
| Molecular Weight | 801.38 g/mol |
| Exact Mass | 800.64 |
| IUPAC Name | [14-decanoyloxy-1,15-bis(hexylsulfanyl)-8-hydroxypentadecan-2-yl] decanoate |
| SMILES | CCCCCCCCCC(=O)OC(CCCCCC(O)CCCCCC(CSCCCCCC)OC(=O)CCCCCCCCC)CSCCCCCC |
| InChI | InChI=1S/C47H92O5S2/c1-5-9-13-17-19-21-29-37-46(49)51-44(41-53-39-31-15-11-7-3)35-27-23-25-33-43(48)34-26-24-28-36-45(42-54-40-32-16-12-8-4)52-47(50)38-30-22-20-18-14-10-6-2/h43-45,48H,5-42H2,1-4H3 |
| InChIKey | JPZALSSTRUCADU-UHFFFAOYSA-N |
| XLogP | 14.98 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 44 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 801.38 |
| LogP ≤ 5 | 14.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|