C23H28FN3O2 — CID 171487588
3-benzyl-1-[[1-[2-(4-fluorophenyl)-2-oxoethyl]piperidin-4-yl]methyl]-1-methylurea (PubChem CID 171487588) has the molecular formula C23H28FN3O2 and a molecular weight of 397.49 g/mol. Its IUPAC name is 3-benzyl-1-[[1-[2-(4-fluorophenyl)-2-oxoethyl]piperidin-4-yl]methyl]-1-methylurea.
| Compound Name | 3-benzyl-1-[[1-[2-(4-fluorophenyl)-2-oxoethyl]piperidin-4-yl]methyl]-1-methylurea |
|---|---|
| PubChem CID | 171487588 |
| Molecular Formula | C23H28FN3O2 |
| Molecular Weight | 397.49 g/mol |
| Exact Mass | 397.22 |
| IUPAC Name | 3-benzyl-1-[[1-[2-(4-fluorophenyl)-2-oxoethyl]piperidin-4-yl]methyl]-1-methylurea |
| SMILES | CN(CC1CCN(CC(=O)c2ccc(F)cc2)CC1)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C23H28FN3O2/c1-26(23(29)25-15-18-5-3-2-4-6-18)16-19-11-13-27(14-12-19)17-22(28)20-7-9-21(24)10-8-20/h2-10,19H,11-17H2,1H3,(H,25,29) |
| InChIKey | UIOYVCVEMGTEQG-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.49 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |