C23H24FN5O3S — CID 171487885
[1-[[(5R)-2-[2-(4-fluorophenyl)-6,7-dihydro-4H-[1,3]oxazolo[4,5-c]pyridin-5-yl]-5-oxo-6,7-dihydrothieno[3,2-d]pyrimidin-4-yl]amino]cyclobutyl]methanol (PubChem CID 171487885) has the molecular formula C23H24FN5O3S and a molecular weight of 469.54 g/mol. Its IUPAC name is [1-[[(5R)-2-[2-(4-fluorophenyl)-6,7-dihydro-4H-[1,3]oxazolo[4,5-c]pyridin-5-yl]-5-oxo-6,7-dihydrothieno[3,2-d]pyrimidin-4-yl]amino]cyclobutyl]methanol.
| Compound Name | [1-[[(5R)-2-[2-(4-fluorophenyl)-6,7-dihydro-4H-[1,3]oxazolo[4,5-c]pyridin-5-yl]-5-oxo-6,7-dihydrothieno[3,2-d]pyrimidin-4-yl]amino]cyclobutyl]methanol |
|---|---|
| PubChem CID | 171487885 |
| Molecular Formula | C23H24FN5O3S |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.16 |
| IUPAC Name | [1-[[(5R)-2-[2-(4-fluorophenyl)-6,7-dihydro-4H-[1,3]oxazolo[4,5-c]pyridin-5-yl]-5-oxo-6,7-dihydrothieno[3,2-d]pyrimidin-4-yl]amino]cyclobutyl]methanol |
| SMILES | O=[S@@]1CCc2nc(N3CCc4oc(-c5ccc(F)cc5)nc4C3)nc(NC3(CO)CCC3)c21 |
| InChI | InChI=1S/C23H24FN5O3S/c24-15-4-2-14(3-5-15)21-25-17-12-29(10-6-18(17)32-21)22-26-16-7-11-33(31)19(16)20(27-22)28-23(13-30)8-1-9-23/h2-5,30H,1,6-13H2,(H,26,27,28)/t33-/m1/s1 |
| InChIKey | ZRIWALPMODPZRM-MGBGTMOVSA-N |
| XLogP | 2.82 |
| TPSA | 104.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |