About 1-(4-ethynyl-3,6-dihydro-2H-pyridin-1-yl)-2-methoxyethanone
1-(4-ethynyl-3,6-dihydro-2H-pyridin-1-yl)-2-methoxyethanone (PubChem CID 171488180) has the molecular formula C10H13NO2
and a molecular weight of 179.22 g/mol. Its IUPAC name is 1-(4-ethynyl-3,6-dihydro-2H-pyridin-1-yl)-2-methoxyethanone.
Molecular Properties
| Compound Name | 1-(4-ethynyl-3,6-dihydro-2H-pyridin-1-yl)-2-methoxyethanone |
| PubChem CID | 171488180 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | 1-(4-ethynyl-3,6-dihydro-2H-pyridin-1-yl)-2-methoxyethanone |
| SMILES | C#CC1=CCN(C(=O)COC)CC1 |
| InChI | InChI=1S/C10H13NO2/c1-3-9-4-6-11(7-5-9)10(12)8-13-2/h1,4H,5-8H2,2H3 |
| InChIKey | UMOGEJRLLKBAJD-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-ethynyl-3,6-dihydro-2H-pyridin-1-yl)-2-methoxyethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-ethynyl-3,6-dihydro-2H-pyridin-1-yl)-2-methoxyethanone?
The IUPAC name of 1-(4-ethynyl-3,6-dihydro-2H-pyridin-1-yl)-2-methoxyethanone (CID 171488180) is 1-(4-ethynyl-3,6-dihydro-2H-pyridin-1-yl)-2-methoxyethanone.
What is the SMILES notation for 1-(4-ethynyl-3,6-dihydro-2H-pyridin-1-yl)-2-methoxyethanone?
The canonical SMILES for 1-(4-ethynyl-3,6-dihydro-2H-pyridin-1-yl)-2-methoxyethanone is C#CC1=CCN(C(=O)COC)CC1.
What is the InChIKey of 1-(4-ethynyl-3,6-dihydro-2H-pyridin-1-yl)-2-methoxyethanone?
The InChIKey is UMOGEJRLLKBAJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO2/c1-3-9-4-6-11(7-5-9)10(12)8-13-2/h1,4H,5-8H2,2H3.
What are the key properties of 1-(4-ethynyl-3,6-dihydro-2H-pyridin-1-yl)-2-methoxyethanone?
1-(4-ethynyl-3,6-dihydro-2H-pyridin-1-yl)-2-methoxyethanone has a molecular weight of 179.22 g/mol, XLogP of 0.42, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-ethynyl-3,6-dihydro-2H-pyridin-1-yl)-2-methoxyethanone is sourced from PubChem (CID 171488180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).