C27H28F3N3O6S — CID 171488246
3-[2-[4-[3-[[2-[(1S)-1-[(2S)-oxan-2-yl]oxyethyl]imidazol-1-yl]methyl]-1,2-oxazol-5-yl]phenyl]ethynyl]-1-(trifluoromethyl)cyclobutane-1-sulfonic acid (PubChem CID 171488246) has the molecular formula C27H28F3N3O6S and a molecular weight of 579.60 g/mol. Its IUPAC name is 3-[2-[4-[3-[[2-[(1S)-1-[(2S)-oxan-2-yl]oxyethyl]imidazol-1-yl]methyl]-1,2-oxazol-5-yl]phenyl]ethynyl]-1-(trifluoromethyl)cyclobutane-1-sulfonic acid.
| Compound Name | 3-[2-[4-[3-[[2-[(1S)-1-[(2S)-oxan-2-yl]oxyethyl]imidazol-1-yl]methyl]-1,2-oxazol-5-yl]phenyl]ethynyl]-1-(trifluoromethyl)cyclobutane-1-sulfonic acid |
|---|---|
| PubChem CID | 171488246 |
| Molecular Formula | C27H28F3N3O6S |
| Molecular Weight | 579.60 g/mol |
| Exact Mass | 579.17 |
| IUPAC Name | 3-[2-[4-[3-[[2-[(1S)-1-[(2S)-oxan-2-yl]oxyethyl]imidazol-1-yl]methyl]-1,2-oxazol-5-yl]phenyl]ethynyl]-1-(trifluoromethyl)cyclobutane-1-sulfonic acid |
| SMILES | C[C@H](O[C@H]1CCCCO1)c1nccn1Cc1cc(-c2ccc(C#CC3CC(C(F)(F)F)(S(=O)(=O)O)C3)cc2)on1 |
| InChI | InChI=1S/C27H28F3N3O6S/c1-18(38-24-4-2-3-13-37-24)25-31-11-12-33(25)17-22-14-23(39-32-22)21-9-7-19(8-10-21)5-6-20-15-26(16-20,27(28,29)30)40(34,35)36/h7-12,14,18,20,24H,2-4,13,15-17H2,1H3,(H,34,35,36)/t18-,20?,24-,26?/m0/s1 |
| InChIKey | YTJAWWLCAGOZCI-WJYKTRORSA-N |
| XLogP | 5.14 |
| TPSA | 116.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.60 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|