About 2,5,5-trimethyl-6-propan-2-yl-1,3-diazepine
2,5,5-trimethyl-6-propan-2-yl-1,3-diazepine (PubChem CID 171488510) has the molecular formula C11H18N2
and a molecular weight of 178.28 g/mol. Its IUPAC name is 2,5,5-trimethyl-6-propan-2-yl-1,3-diazepine.
Molecular Properties
| Compound Name | 2,5,5-trimethyl-6-propan-2-yl-1,3-diazepine |
| PubChem CID | 171488510 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | 2,5,5-trimethyl-6-propan-2-yl-1,3-diazepine |
| SMILES | CC1=NC=C(C(C)C)C(C)(C)C=N1 |
| InChI | InChI=1S/C11H18N2/c1-8(2)10-6-12-9(3)13-7-11(10,4)5/h6-8H,1-5H3 |
| InChIKey | MHYQGUJVPJOFAR-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,5,5-trimethyl-6-propan-2-yl-1,3-diazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5,5-trimethyl-6-propan-2-yl-1,3-diazepine?
The IUPAC name of 2,5,5-trimethyl-6-propan-2-yl-1,3-diazepine (CID 171488510) is 2,5,5-trimethyl-6-propan-2-yl-1,3-diazepine.
What is the SMILES notation for 2,5,5-trimethyl-6-propan-2-yl-1,3-diazepine?
The canonical SMILES for 2,5,5-trimethyl-6-propan-2-yl-1,3-diazepine is CC1=NC=C(C(C)C)C(C)(C)C=N1.
What is the InChIKey of 2,5,5-trimethyl-6-propan-2-yl-1,3-diazepine?
The InChIKey is MHYQGUJVPJOFAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2/c1-8(2)10-6-12-9(3)13-7-11(10,4)5/h6-8H,1-5H3.
What are the key properties of 2,5,5-trimethyl-6-propan-2-yl-1,3-diazepine?
2,5,5-trimethyl-6-propan-2-yl-1,3-diazepine has a molecular weight of 178.28 g/mol, XLogP of 3.06, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5,5-trimethyl-6-propan-2-yl-1,3-diazepine is sourced from PubChem (CID 171488510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).