C26H38N+ — CID 171488533
(5-ethenyl-5-methylcyclohepta-1,6-dien-1-yl)methyl-[(5-ethenyl-5-methylcyclohepta-1,3,6-trien-1-yl)methyl]-diethylazanium (PubChem CID 171488533) has the molecular formula C26H38N+ and a molecular weight of 364.60 g/mol. Its IUPAC name is (5-ethenyl-5-methylcyclohepta-1,6-dien-1-yl)methyl-[(5-ethenyl-5-methylcyclohepta-1,3,6-trien-1-yl)methyl]-diethylazanium.
| Compound Name | (5-ethenyl-5-methylcyclohepta-1,6-dien-1-yl)methyl-[(5-ethenyl-5-methylcyclohepta-1,3,6-trien-1-yl)methyl]-diethylazanium |
|---|---|
| PubChem CID | 171488533 |
| Molecular Formula | C26H38N+ |
| Molecular Weight | 364.60 g/mol |
| Exact Mass | 364.30 |
| IUPAC Name | (5-ethenyl-5-methylcyclohepta-1,6-dien-1-yl)methyl-[(5-ethenyl-5-methylcyclohepta-1,3,6-trien-1-yl)methyl]-diethylazanium |
| SMILES | C=CC1(C)C=CC=C(C[N+](CC)(CC)CC2=CCCC(C)(C=C)C=C2)C=C1 |
| InChI | InChI=1S/C26H38N/c1-7-25(5)17-11-13-23(15-19-25)21-27(9-3,10-4)22-24-14-12-18-26(6,8-2)20-16-24/h7-8,11,13-17,19-20H,1-2,9-10,12,18,21-22H2,3-6H3/q+1 |
| InChIKey | BCTXDGVCPZFBAJ-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.60 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|