C18H25N3O2 — CID 171489467
3-[4-(4-cyclopentylpiperazin-1-yl)phenyl]-1,3-oxazolidin-2-one (PubChem CID 171489467) has the molecular formula C18H25N3O2 and a molecular weight of 315.42 g/mol. Its IUPAC name is 3-[4-(4-cyclopentylpiperazin-1-yl)phenyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[4-(4-cyclopentylpiperazin-1-yl)phenyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 171489467 |
| Molecular Formula | C18H25N3O2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.19 |
| IUPAC Name | 3-[4-(4-cyclopentylpiperazin-1-yl)phenyl]-1,3-oxazolidin-2-one |
| SMILES | O=C1OCCN1c1ccc(N2CCN(C3CCCC3)CC2)cc1 |
| InChI | InChI=1S/C18H25N3O2/c22-18-21(13-14-23-18)17-7-5-16(6-8-17)20-11-9-19(10-12-20)15-3-1-2-4-15/h5-8,15H,1-4,9-14H2 |
| InChIKey | VAPLYVNKMXKVPP-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|