C12H21N3O2 — CID 171489904
molecular hydrogen;5-[[[(2R)-oxolan-2-yl]methylamino]methyl]pyridine-2-carboxamide (PubChem CID 171489904) has the molecular formula C12H21N3O2 and a molecular weight of 239.32 g/mol. Its IUPAC name is molecular hydrogen;5-[[[(2R)-oxolan-2-yl]methylamino]methyl]pyridine-2-carboxamide.
| Compound Name | molecular hydrogen;5-[[[(2R)-oxolan-2-yl]methylamino]methyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 171489904 |
| Molecular Formula | C12H21N3O2 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.16 |
| IUPAC Name | molecular hydrogen;5-[[[(2R)-oxolan-2-yl]methylamino]methyl]pyridine-2-carboxamide |
| SMILES | NC(=O)c1ccc(CNC[C@H]2CCCO2)cn1.[H][H].[H][H] |
| InChI | InChI=1S/C12H17N3O2.2H2/c13-12(16)11-4-3-9(7-15-11)6-14-8-10-2-1-5-17-10;;/h3-4,7,10,14H,1-2,5-6,8H2,(H2,13,16);2*1H/t10-;;/m1../s1 |
| InChIKey | QRYRSSQMGGLFOG-YQFADDPSSA-N |
| XLogP | 0.94 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |