C10H11FN2O2 — CID 171490674
ethane;7-fluoro-2-hydroxypyrido[1,2-a]pyrimidin-4-one (PubChem CID 171490674) has the molecular formula C10H11FN2O2 and a molecular weight of 210.21 g/mol. Its IUPAC name is ethane;7-fluoro-2-hydroxypyrido[1,2-a]pyrimidin-4-one.
| Compound Name | ethane;7-fluoro-2-hydroxypyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 171490674 |
| Molecular Formula | C10H11FN2O2 |
| Molecular Weight | 210.21 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | ethane;7-fluoro-2-hydroxypyrido[1,2-a]pyrimidin-4-one |
| SMILES | CC.O=c1cc(O)nc2ccc(F)cn12 |
| InChI | InChI=1S/C8H5FN2O2.C2H6/c9-5-1-2-6-10-7(12)3-8(13)11(6)4-5;1-2/h1-4,12H;1-2H3 |
| InChIKey | NUUHGMXRFXEKGW-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.21 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |