C19H33N3O — CID 171492437
cyclohexanamine;1-ethyl-4-(2-methoxyphenyl)piperazine (PubChem CID 171492437) has the molecular formula C19H33N3O and a molecular weight of 319.49 g/mol. Its IUPAC name is cyclohexanamine;1-ethyl-4-(2-methoxyphenyl)piperazine.
| Compound Name | cyclohexanamine;1-ethyl-4-(2-methoxyphenyl)piperazine |
|---|---|
| PubChem CID | 171492437 |
| Molecular Formula | C19H33N3O |
| Molecular Weight | 319.49 g/mol |
| Exact Mass | 319.26 |
| IUPAC Name | cyclohexanamine;1-ethyl-4-(2-methoxyphenyl)piperazine |
| SMILES | CCN1CCN(c2ccccc2OC)CC1.NC1CCCCC1 |
| InChI | InChI=1S/C13H20N2O.C6H13N/c1-3-14-8-10-15(11-9-14)12-6-4-5-7-13(12)16-2;7-6-4-2-1-3-5-6/h4-7H,3,8-11H2,1-2H3;6H,1-5,7H2 |
| InChIKey | SAUFJNBHORNOOX-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 41.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.49 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |