C31H50O6 — CID 171492630
(3Z,5E,7R,10R,11R,13E,15E)-3,8,10-trihydroxy-5,7,11,13-tetramethyl-18-[(2S)-4-[(2S)-5-methyloxan-2-yl]butan-2-yl]-1-oxacyclooctadeca-3,5,13,15-tetraen-2-one (PubChem CID 171492630) has the molecular formula C31H50O6 and a molecular weight of 518.74 g/mol. Its IUPAC name is (3Z,5E,7R,10R,11R,13E,15E)-3,8,10-trihydroxy-5,7,11,13-tetramethyl-18-[(2S)-4-[(2S)-5-methyloxan-2-yl]butan-2-yl]-1-oxacyclooctadeca-3,5,13,15-tetraen-2-one.
| Compound Name | (3Z,5E,7R,10R,11R,13E,15E)-3,8,10-trihydroxy-5,7,11,13-tetramethyl-18-[(2S)-4-[(2S)-5-methyloxan-2-yl]butan-2-yl]-1-oxacyclooctadeca-3,5,13,15-tetraen-2-one |
|---|---|
| PubChem CID | 171492630 |
| Molecular Formula | C31H50O6 |
| Molecular Weight | 518.74 g/mol |
| Exact Mass | 518.36 |
| IUPAC Name | (3Z,5E,7R,10R,11R,13E,15E)-3,8,10-trihydroxy-5,7,11,13-tetramethyl-18-[(2S)-4-[(2S)-5-methyloxan-2-yl]butan-2-yl]-1-oxacyclooctadeca-3,5,13,15-tetraen-2-one |
| SMILES | CC1=C\[C@@H](C)C(O)C[C@@H](O)[C@H](C)C/C(C)=C/C=C/CC([C@@H](C)CC[C@@H]2CCC(C)CO2)OC(=O)\C(O)=C\1 |
| InChI | InChI=1S/C31H50O6/c1-20-9-7-8-10-30(23(4)12-14-26-13-11-21(2)19-36-26)37-31(35)29(34)17-22(3)16-25(6)28(33)18-27(32)24(5)15-20/h7-9,16-17,21,23-28,30,32-34H,10-15,18-19H2,1-6H3/b8-7+,20-9+,22-16+,29-17-/t21?,23-,24+,25+,26-,27+,28?,30?/m0/s1 |
| InChIKey | IACCOUUZJACDCE-BXNOYAQNSA-N |
| XLogP | 6.20 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.74 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |