C9H13F3N2O — CID 171492708
ethane;3-ethyl-5-(trifluoromethyl)-1H-pyridazin-6-one (PubChem CID 171492708) has the molecular formula C9H13F3N2O and a molecular weight of 222.21 g/mol. Its IUPAC name is ethane;3-ethyl-5-(trifluoromethyl)-1H-pyridazin-6-one.
| Compound Name | ethane;3-ethyl-5-(trifluoromethyl)-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 171492708 |
| Molecular Formula | C9H13F3N2O |
| Molecular Weight | 222.21 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | ethane;3-ethyl-5-(trifluoromethyl)-1H-pyridazin-6-one |
| SMILES | CC.CCc1cc(C(F)(F)F)c(=O)[nH]n1 |
| InChI | InChI=1S/C7H7F3N2O.C2H6/c1-2-4-3-5(7(8,9)10)6(13)12-11-4;1-2/h3H,2H2,1H3,(H,12,13);1-2H3 |
| InChIKey | IHYCCJIKPUWABN-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.21 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |