About 3-[[(E)-2,2-difluoropent-3-enyl]amino]-1-(4-methylpiperidin-1-yl)propan-1-one
3-[[(E)-2,2-difluoropent-3-enyl]amino]-1-(4-methylpiperidin-1-yl)propan-1-one (PubChem CID 171492766) has the molecular formula C14H24F2N2O
and a molecular weight of 274.35 g/mol. Its IUPAC name is 3-[[(E)-2,2-difluoropent-3-enyl]amino]-1-(4-methylpiperidin-1-yl)propan-1-one.
Molecular Properties
| Compound Name | 3-[[(E)-2,2-difluoropent-3-enyl]amino]-1-(4-methylpiperidin-1-yl)propan-1-one |
| PubChem CID | 171492766 |
| Molecular Formula | C14H24F2N2O |
| Molecular Weight | 274.35 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | 3-[[(E)-2,2-difluoropent-3-enyl]amino]-1-(4-methylpiperidin-1-yl)propan-1-one |
| SMILES | C/C=C/C(F)(F)CNCCC(=O)N1CCC(C)CC1 |
| InChI | InChI=1S/C14H24F2N2O/c1-3-7-14(15,16)11-17-8-4-13(19)18-9-5-12(2)6-10-18/h3,7,12,17H,4-6,8-11H2,1-2H3/b7-3+ |
| InChIKey | PXEUHEVJFGFWTO-XVNBXDOJSA-N |
| XLogP | 2.44 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.35 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-[[(E)-2,2-difluoropent-3-enyl]amino]-1-(4-methylpiperidin-1-yl)propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[(E)-2,2-difluoropent-3-enyl]amino]-1-(4-methylpiperidin-1-yl)propan-1-one?
The IUPAC name of 3-[[(E)-2,2-difluoropent-3-enyl]amino]-1-(4-methylpiperidin-1-yl)propan-1-one (CID 171492766) is 3-[[(E)-2,2-difluoropent-3-enyl]amino]-1-(4-methylpiperidin-1-yl)propan-1-one.
What is the SMILES notation for 3-[[(E)-2,2-difluoropent-3-enyl]amino]-1-(4-methylpiperidin-1-yl)propan-1-one?
The canonical SMILES for 3-[[(E)-2,2-difluoropent-3-enyl]amino]-1-(4-methylpiperidin-1-yl)propan-1-one is C/C=C/C(F)(F)CNCCC(=O)N1CCC(C)CC1.
What is the InChIKey of 3-[[(E)-2,2-difluoropent-3-enyl]amino]-1-(4-methylpiperidin-1-yl)propan-1-one?
The InChIKey is PXEUHEVJFGFWTO-XVNBXDOJSA-N. The full InChI is InChI=1S/C14H24F2N2O/c1-3-7-14(15,16)11-17-8-4-13(19)18-9-5-12(2)6-10-18/h3,7,12,17H,4-6,8-11H2,1-2H3/b7-3+.
What are the key properties of 3-[[(E)-2,2-difluoropent-3-enyl]amino]-1-(4-methylpiperidin-1-yl)propan-1-one?
3-[[(E)-2,2-difluoropent-3-enyl]amino]-1-(4-methylpiperidin-1-yl)propan-1-one has a molecular weight of 274.35 g/mol, XLogP of 2.44, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[(E)-2,2-difluoropent-3-enyl]amino]-1-(4-methylpiperidin-1-yl)propan-1-one is sourced from PubChem (CID 171492766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).