C8H6BrF3N2O — CID 171492806
7-bromo-4-(trifluoromethyl)-2,5,6,7-tetrahydrocyclopenta[c]pyridazin-3-one (PubChem CID 171492806) has the molecular formula C8H6BrF3N2O and a molecular weight of 283.05 g/mol. Its IUPAC name is 7-bromo-4-(trifluoromethyl)-2,5,6,7-tetrahydrocyclopenta[c]pyridazin-3-one.
| Compound Name | 7-bromo-4-(trifluoromethyl)-2,5,6,7-tetrahydrocyclopenta[c]pyridazin-3-one |
|---|---|
| PubChem CID | 171492806 |
| Molecular Formula | C8H6BrF3N2O |
| Molecular Weight | 283.05 g/mol |
| Exact Mass | 281.96 |
| IUPAC Name | 7-bromo-4-(trifluoromethyl)-2,5,6,7-tetrahydrocyclopenta[c]pyridazin-3-one |
| SMILES | O=c1[nH]nc2c(c1C(F)(F)F)CCC2Br |
| InChI | InChI=1S/C8H6BrF3N2O/c9-4-2-1-3-5(8(10,11)12)7(15)14-13-6(3)4/h4H,1-2H2,(H,14,15) |
| InChIKey | CLXDGIXUVDNSKN-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.05 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|