C18H26F3N3O2 — CID 171492890
2-[3-oxo-4-(trifluoromethyl)-2,5,6,7-tetrahydrocyclopenta[c]pyridazin-7-yl]-N-pentyl-N-propylacetamide (PubChem CID 171492890) has the molecular formula C18H26F3N3O2 and a molecular weight of 373.42 g/mol. Its IUPAC name is 2-[3-oxo-4-(trifluoromethyl)-2,5,6,7-tetrahydrocyclopenta[c]pyridazin-7-yl]-N-pentyl-N-propylacetamide.
| Compound Name | 2-[3-oxo-4-(trifluoromethyl)-2,5,6,7-tetrahydrocyclopenta[c]pyridazin-7-yl]-N-pentyl-N-propylacetamide |
|---|---|
| PubChem CID | 171492890 |
| Molecular Formula | C18H26F3N3O2 |
| Molecular Weight | 373.42 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | 2-[3-oxo-4-(trifluoromethyl)-2,5,6,7-tetrahydrocyclopenta[c]pyridazin-7-yl]-N-pentyl-N-propylacetamide |
| SMILES | CCCCCN(CCC)C(=O)CC1CCc2c1n[nH]c(=O)c2C(F)(F)F |
| InChI | InChI=1S/C18H26F3N3O2/c1-3-5-6-10-24(9-4-2)14(25)11-12-7-8-13-15(18(19,20)21)17(26)23-22-16(12)13/h12H,3-11H2,1-2H3,(H,23,26) |
| InChIKey | JVVNBRMWPLEAJX-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.42 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|