C30H41F3N6O3 — CID 171493061
N-[5-(5-cyano-2-pyridinyl)pentyl]-N-propylformamide;4-(trifluoromethyl)-7-(2,2,6-trimethylmorpholin-4-yl)-2,5,6,7-tetrahydrocyclopenta[c]pyridazin-3-one (PubChem CID 171493061) has the molecular formula C30H41F3N6O3 and a molecular weight of 590.69 g/mol. Its IUPAC name is N-[5-(5-cyano-2-pyridinyl)pentyl]-N-propylformamide;4-(trifluoromethyl)-7-(2,2,6-trimethylmorpholin-4-yl)-2,5,6,7-tetrahydrocyclopenta[c]pyridazin-3-one.
| Compound Name | N-[5-(5-cyano-2-pyridinyl)pentyl]-N-propylformamide;4-(trifluoromethyl)-7-(2,2,6-trimethylmorpholin-4-yl)-2,5,6,7-tetrahydrocyclopenta[c]pyridazin-3-one |
|---|---|
| PubChem CID | 171493061 |
| Molecular Formula | C30H41F3N6O3 |
| Molecular Weight | 590.69 g/mol |
| Exact Mass | 590.32 |
| IUPAC Name | N-[5-(5-cyano-2-pyridinyl)pentyl]-N-propylformamide;4-(trifluoromethyl)-7-(2,2,6-trimethylmorpholin-4-yl)-2,5,6,7-tetrahydrocyclopenta[c]pyridazin-3-one |
| SMILES | CC1CN(C2CCc3c2n[nH]c(=O)c3C(F)(F)F)CC(C)(C)O1.CCCN(C=O)CCCCCc1ccc(C#N)cn1 |
| InChI | InChI=1S/C15H20F3N3O2.C15H21N3O/c1-8-6-21(7-14(2,3)23-8)10-5-4-9-11(15(16,17)18)13(22)20-19-12(9)10;1-2-9-18(13-19)10-5-3-4-6-15-8-7-14(11-16)12-17-15/h8,10H,4-7H2,1-3H3,(H,20,22);7-8,12-13H,2-6,9-10H2,1H3 |
| InChIKey | LXFPOELPELRGOG-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 115.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.69 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|