C11H11F3N3ORb — CID 171493445
CID 171493445 (PubChem CID 171493445) has the molecular formula C11H11F3N3ORb and a molecular weight of 343.69 g/mol.
| Compound Name | CID 171493445 |
|---|---|
| PubChem CID | 171493445 |
| Molecular Formula | C11H11F3N3ORb |
| Molecular Weight | 343.69 g/mol |
| Exact Mass | 343.00 |
| IUPAC Name | — |
| SMILES | O=c1[nH]nc2c(c1C(F)(F)F)CCC2N1[CH-]CC1.[Rb+] |
| InChI | InChI=1S/C11H11F3N3O.Rb/c12-11(13,14)8-6-2-3-7(17-4-1-5-17)9(6)15-16-10(8)18;/h4,7H,1-3,5H2,(H,16,18);/q-1;+1 |
| InChIKey | IFDRXJQJQBIOQK-UHFFFAOYSA-N |
| XLogP | -1.35 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.69 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|