C23H38F3N3O3 — CID 171493452
tert-butyl 6-[4-[[(Z)-[(E)-2-(trifluoromethyl)but-2-enylidene]amino]methyl]piperazine-1-carbonyl]octanoate (PubChem CID 171493452) has the molecular formula C23H38F3N3O3 and a molecular weight of 461.57 g/mol. Its IUPAC name is tert-butyl 6-[4-[[(Z)-[(E)-2-(trifluoromethyl)but-2-enylidene]amino]methyl]piperazine-1-carbonyl]octanoate.
| Compound Name | tert-butyl 6-[4-[[(Z)-[(E)-2-(trifluoromethyl)but-2-enylidene]amino]methyl]piperazine-1-carbonyl]octanoate |
|---|---|
| PubChem CID | 171493452 |
| Molecular Formula | C23H38F3N3O3 |
| Molecular Weight | 461.57 g/mol |
| Exact Mass | 461.29 |
| IUPAC Name | tert-butyl 6-[4-[[(Z)-[(E)-2-(trifluoromethyl)but-2-enylidene]amino]methyl]piperazine-1-carbonyl]octanoate |
| SMILES | C/C=C(\C=N/CN1CCN(C(=O)C(CC)CCCCC(=O)OC(C)(C)C)CC1)C(F)(F)F |
| InChI | InChI=1S/C23H38F3N3O3/c1-6-18(10-8-9-11-20(30)32-22(3,4)5)21(31)29-14-12-28(13-15-29)17-27-16-19(7-2)23(24,25)26/h7,16,18H,6,8-15,17H2,1-5H3/b19-7+,27-16- |
| InChIKey | SPNIYNGQPFLKKP-SLTQOYJNSA-N |
| XLogP | 4.60 |
| TPSA | 62.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.57 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|