About ethyl 1-methyl-2-oxo-3-(1,1,1-trifluoro-2-hydroxy-3-methoxy-3-oxopropan-2-yl)cyclopentane-1-carboxylate
ethyl 1-methyl-2-oxo-3-(1,1,1-trifluoro-2-hydroxy-3-methoxy-3-oxopropan-2-yl)cyclopentane-1-carboxylate (PubChem CID 171493547) has the molecular formula C13H17F3O6
and a molecular weight of 326.27 g/mol. Its IUPAC name is ethyl 1-methyl-2-oxo-3-(1,1,1-trifluoro-2-hydroxy-3-methoxy-3-oxopropan-2-yl)cyclopentane-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 1-methyl-2-oxo-3-(1,1,1-trifluoro-2-hydroxy-3-methoxy-3-oxopropan-2-yl)cyclopentane-1-carboxylate |
| PubChem CID | 171493547 |
| Molecular Formula | C13H17F3O6 |
| Molecular Weight | 326.27 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | ethyl 1-methyl-2-oxo-3-(1,1,1-trifluoro-2-hydroxy-3-methoxy-3-oxopropan-2-yl)cyclopentane-1-carboxylate |
| SMILES | CCOC(=O)C1(C)CCC(C(O)(C(=O)OC)C(F)(F)F)C1=O |
| InChI | InChI=1S/C13H17F3O6/c1-4-22-9(18)11(2)6-5-7(8(11)17)12(20,10(19)21-3)13(14,15)16/h7,20H,4-6H2,1-3H3 |
| InChIKey | XSTZGOTUSAMXCL-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.27 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze ethyl 1-methyl-2-oxo-3-(1,1,1-trifluoro-2-hydroxy-3-methoxy-3-oxopropan-2-yl)cyclopentane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-methyl-2-oxo-3-(1,1,1-trifluoro-2-hydroxy-3-methoxy-3-oxopropan-2-yl)cyclopentane-1-carboxylate?
The IUPAC name of ethyl 1-methyl-2-oxo-3-(1,1,1-trifluoro-2-hydroxy-3-methoxy-3-oxopropan-2-yl)cyclopentane-1-carboxylate (CID 171493547) is ethyl 1-methyl-2-oxo-3-(1,1,1-trifluoro-2-hydroxy-3-methoxy-3-oxopropan-2-yl)cyclopentane-1-carboxylate.
What is the SMILES notation for ethyl 1-methyl-2-oxo-3-(1,1,1-trifluoro-2-hydroxy-3-methoxy-3-oxopropan-2-yl)cyclopentane-1-carboxylate?
The canonical SMILES for ethyl 1-methyl-2-oxo-3-(1,1,1-trifluoro-2-hydroxy-3-methoxy-3-oxopropan-2-yl)cyclopentane-1-carboxylate is CCOC(=O)C1(C)CCC(C(O)(C(=O)OC)C(F)(F)F)C1=O.
What is the InChIKey of ethyl 1-methyl-2-oxo-3-(1,1,1-trifluoro-2-hydroxy-3-methoxy-3-oxopropan-2-yl)cyclopentane-1-carboxylate?
The InChIKey is XSTZGOTUSAMXCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17F3O6/c1-4-22-9(18)11(2)6-5-7(8(11)17)12(20,10(19)21-3)13(14,15)16/h7,20H,4-6H2,1-3H3.
What are the key properties of ethyl 1-methyl-2-oxo-3-(1,1,1-trifluoro-2-hydroxy-3-methoxy-3-oxopropan-2-yl)cyclopentane-1-carboxylate?
ethyl 1-methyl-2-oxo-3-(1,1,1-trifluoro-2-hydroxy-3-methoxy-3-oxopropan-2-yl)cyclopentane-1-carboxylate has a molecular weight of 326.27 g/mol, XLogP of 1.00, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-methyl-2-oxo-3-(1,1,1-trifluoro-2-hydroxy-3-methoxy-3-oxopropan-2-yl)cyclopentane-1-carboxylate is sourced from PubChem (CID 171493547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).