C18H25N5O3 — CID 171493631
tert-butyl N-[2-[4-(5-cyano-2-pyridinyl)piperazin-1-yl]-2-oxoethyl]-N-methylcarbamate (PubChem CID 171493631) has the molecular formula C18H25N5O3 and a molecular weight of 359.43 g/mol. Its IUPAC name is tert-butyl N-[2-[4-(5-cyano-2-pyridinyl)piperazin-1-yl]-2-oxoethyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[2-[4-(5-cyano-2-pyridinyl)piperazin-1-yl]-2-oxoethyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 171493631 |
| Molecular Formula | C18H25N5O3 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | tert-butyl N-[2-[4-(5-cyano-2-pyridinyl)piperazin-1-yl]-2-oxoethyl]-N-methylcarbamate |
| SMILES | CN(CC(=O)N1CCN(c2ccc(C#N)cn2)CC1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H25N5O3/c1-18(2,3)26-17(25)21(4)13-16(24)23-9-7-22(8-10-23)15-6-5-14(11-19)12-20-15/h5-6,12H,7-10,13H2,1-4H3 |
| InChIKey | RUKHVIVXOLCGJV-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 89.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |