C22H35F3N4OS — CID 171493640
7-[ethyl-[3-[pentyl(propyl)amino]-2-sulfanylbut-3-enyl]amino]-4-(trifluoromethyl)-2,5,6,7-tetrahydrocyclopenta[c]pyridazin-3-one (PubChem CID 171493640) has the molecular formula C22H35F3N4OS and a molecular weight of 460.61 g/mol. Its IUPAC name is 7-[ethyl-[3-[pentyl(propyl)amino]-2-sulfanylbut-3-enyl]amino]-4-(trifluoromethyl)-2,5,6,7-tetrahydrocyclopenta[c]pyridazin-3-one.
| Compound Name | 7-[ethyl-[3-[pentyl(propyl)amino]-2-sulfanylbut-3-enyl]amino]-4-(trifluoromethyl)-2,5,6,7-tetrahydrocyclopenta[c]pyridazin-3-one |
|---|---|
| PubChem CID | 171493640 |
| Molecular Formula | C22H35F3N4OS |
| Molecular Weight | 460.61 g/mol |
| Exact Mass | 460.25 |
| IUPAC Name | 7-[ethyl-[3-[pentyl(propyl)amino]-2-sulfanylbut-3-enyl]amino]-4-(trifluoromethyl)-2,5,6,7-tetrahydrocyclopenta[c]pyridazin-3-one |
| SMILES | C=C(C(S)CN(CC)C1CCc2c1n[nH]c(=O)c2C(F)(F)F)N(CCC)CCCCC |
| InChI | InChI=1S/C22H35F3N4OS/c1-5-8-9-13-29(12-6-2)15(4)18(31)14-28(7-3)17-11-10-16-19(22(23,24)25)21(30)27-26-20(16)17/h17-18,31H,4-14H2,1-3H3,(H,27,30) |
| InChIKey | BJDRFSQWXNOZHY-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.61 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|