C18H16Cl2O4 — CID 17149557
[4-(2-methylpropoxycarbonyl)phenyl] 2,4-dichlorobenzoate (PubChem CID 17149557) has the molecular formula C18H16Cl2O4 and a molecular weight of 367.23 g/mol. Its IUPAC name is [4-(2-methylpropoxycarbonyl)phenyl] 2,4-dichlorobenzoate.
| Compound Name | [4-(2-methylpropoxycarbonyl)phenyl] 2,4-dichlorobenzoate |
|---|---|
| PubChem CID | 17149557 |
| Molecular Formula | C18H16Cl2O4 |
| Molecular Weight | 367.23 g/mol |
| Exact Mass | 366.04 |
| IUPAC Name | [4-(2-methylpropoxycarbonyl)phenyl] 2,4-dichlorobenzoate |
| SMILES | CC(C)COC(=O)c1ccc(OC(=O)c2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C18H16Cl2O4/c1-11(2)10-23-17(21)12-3-6-14(7-4-12)24-18(22)15-8-5-13(19)9-16(15)20/h3-9,11H,10H2,1-2H3 |
| InChIKey | FCYPQSPUDWCHTK-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.23 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|