C19H28F3NO — CID 171496510
5-ethenyl-4-[(3E,5E)-3-ethyl-7,7,7-trifluoro-6-methylhepta-1,3,5-trien-2-yl]-3,6-dihydro-2H-pyran;N-methylmethanamine (PubChem CID 171496510) has the molecular formula C19H28F3NO and a molecular weight of 343.43 g/mol. Its IUPAC name is 5-ethenyl-4-[(3E,5E)-3-ethyl-7,7,7-trifluoro-6-methylhepta-1,3,5-trien-2-yl]-3,6-dihydro-2H-pyran;N-methylmethanamine.
| Compound Name | 5-ethenyl-4-[(3E,5E)-3-ethyl-7,7,7-trifluoro-6-methylhepta-1,3,5-trien-2-yl]-3,6-dihydro-2H-pyran;N-methylmethanamine |
|---|---|
| PubChem CID | 171496510 |
| Molecular Formula | C19H28F3NO |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.21 |
| IUPAC Name | 5-ethenyl-4-[(3E,5E)-3-ethyl-7,7,7-trifluoro-6-methylhepta-1,3,5-trien-2-yl]-3,6-dihydro-2H-pyran;N-methylmethanamine |
| SMILES | C=CC1=C(C(=C)/C(=C/C=C(\C)C(F)(F)F)CC)CCOC1.CNC |
| InChI | InChI=1S/C17H21F3O.C2H7N/c1-5-14(8-7-12(3)17(18,19)20)13(4)16-9-10-21-11-15(16)6-2;1-3-2/h6-8H,2,4-5,9-11H2,1,3H3;3H,1-2H3/b12-7+,14-8+; |
| InChIKey | KGAQHVGCNAJXLV-CJZTUVBTSA-N |
| XLogP | 5.13 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|