C19H26N2O — CID 171496576
(2E,4E)-6-[5-ethenyl-6-(methylaminomethyl)-3,6-dihydro-2H-pyran-4-yl]-5-ethyl-2-methylhepta-2,4,6-trienenitrile (PubChem CID 171496576) has the molecular formula C19H26N2O and a molecular weight of 298.43 g/mol. Its IUPAC name is (2E,4E)-6-[5-ethenyl-6-(methylaminomethyl)-3,6-dihydro-2H-pyran-4-yl]-5-ethyl-2-methylhepta-2,4,6-trienenitrile.
| Compound Name | (2E,4E)-6-[5-ethenyl-6-(methylaminomethyl)-3,6-dihydro-2H-pyran-4-yl]-5-ethyl-2-methylhepta-2,4,6-trienenitrile |
|---|---|
| PubChem CID | 171496576 |
| Molecular Formula | C19H26N2O |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.20 |
| IUPAC Name | (2E,4E)-6-[5-ethenyl-6-(methylaminomethyl)-3,6-dihydro-2H-pyran-4-yl]-5-ethyl-2-methylhepta-2,4,6-trienenitrile |
| SMILES | C=CC1=C(C(=C)/C(=C/C=C(\C)C#N)CC)CCOC1CNC |
| InChI | InChI=1S/C19H26N2O/c1-6-16(9-8-14(3)12-20)15(4)18-10-11-22-19(13-21-5)17(18)7-2/h7-9,19,21H,2,4,6,10-11,13H2,1,3,5H3/b14-8+,16-9+ |
| InChIKey | ILTVEMUBABIELY-JTHWEQIXSA-N |
| XLogP | 3.84 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|