C17H22N2O — CID 171496758
(3Z)-6-(4-ethenyl-3,6-dihydro-2H-pyran-5-yl)-2,5-dimethylidenehepta-3,6-dienenitrile;methanamine (PubChem CID 171496758) has the molecular formula C17H22N2O and a molecular weight of 270.38 g/mol. Its IUPAC name is (3Z)-6-(4-ethenyl-3,6-dihydro-2H-pyran-5-yl)-2,5-dimethylidenehepta-3,6-dienenitrile;methanamine.
| Compound Name | (3Z)-6-(4-ethenyl-3,6-dihydro-2H-pyran-5-yl)-2,5-dimethylidenehepta-3,6-dienenitrile;methanamine |
|---|---|
| PubChem CID | 171496758 |
| Molecular Formula | C17H22N2O |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | (3Z)-6-(4-ethenyl-3,6-dihydro-2H-pyran-5-yl)-2,5-dimethylidenehepta-3,6-dienenitrile;methanamine |
| SMILES | C=CC1=C(C(=C)C(=C)/C=C\C(=C)C#N)COCC1.CN |
| InChI | InChI=1S/C16H17NO.CH5N/c1-5-15-8-9-18-11-16(15)14(4)13(3)7-6-12(2)10-17;1-2/h5-7H,1-4,8-9,11H2;2H2,1H3/b7-6-; |
| InChIKey | NLXDOIACASNZAK-NAFXZHHSSA-N |
| XLogP | 3.21 |
| TPSA | 59.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|