C17H15BrF2N4O2 — CID 171496880
2-(6-bromo-2-oxo-1,4-dihydropyrido[3,2-d]pyrimidin-3-yl)-N-[(1S)-1-(2,4-difluorophenyl)ethyl]acetamide (PubChem CID 171496880) has the molecular formula C17H15BrF2N4O2 and a molecular weight of 425.23 g/mol. Its IUPAC name is 2-(6-bromo-2-oxo-1,4-dihydropyrido[3,2-d]pyrimidin-3-yl)-N-[(1S)-1-(2,4-difluorophenyl)ethyl]acetamide.
| Compound Name | 2-(6-bromo-2-oxo-1,4-dihydropyrido[3,2-d]pyrimidin-3-yl)-N-[(1S)-1-(2,4-difluorophenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 171496880 |
| Molecular Formula | C17H15BrF2N4O2 |
| Molecular Weight | 425.23 g/mol |
| Exact Mass | 424.03 |
| IUPAC Name | 2-(6-bromo-2-oxo-1,4-dihydropyrido[3,2-d]pyrimidin-3-yl)-N-[(1S)-1-(2,4-difluorophenyl)ethyl]acetamide |
| SMILES | C[C@H](NC(=O)CN1Cc2nc(Br)ccc2NC1=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C17H15BrF2N4O2/c1-9(11-3-2-10(19)6-12(11)20)21-16(25)8-24-7-14-13(23-17(24)26)4-5-15(18)22-14/h2-6,9H,7-8H2,1H3,(H,21,25)(H,23,26)/t9-/m0/s1 |
| InChIKey | ZHAOIPKJANDPQC-VIFPVBQESA-N |
| XLogP | 3.35 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.23 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|