About methyl 2-(6-fluoro-2-oxo-1,4-dihydroquinazolin-3-yl)-4-methylpentanoate
methyl 2-(6-fluoro-2-oxo-1,4-dihydroquinazolin-3-yl)-4-methylpentanoate (PubChem CID 171497217) has the molecular formula C15H19FN2O3
and a molecular weight of 294.33 g/mol. Its IUPAC name is methyl 2-(6-fluoro-2-oxo-1,4-dihydroquinazolin-3-yl)-4-methylpentanoate.
Molecular Properties
| Compound Name | methyl 2-(6-fluoro-2-oxo-1,4-dihydroquinazolin-3-yl)-4-methylpentanoate |
| PubChem CID | 171497217 |
| Molecular Formula | C15H19FN2O3 |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | methyl 2-(6-fluoro-2-oxo-1,4-dihydroquinazolin-3-yl)-4-methylpentanoate |
| SMILES | COC(=O)C(CC(C)C)N1Cc2cc(F)ccc2NC1=O |
| InChI | InChI=1S/C15H19FN2O3/c1-9(2)6-13(14(19)21-3)18-8-10-7-11(16)4-5-12(10)17-15(18)20/h4-5,7,9,13H,6,8H2,1-3H3,(H,17,20) |
| InChIKey | IYNGGWUIAQMVQP-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 2-(6-fluoro-2-oxo-1,4-dihydroquinazolin-3-yl)-4-methylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(6-fluoro-2-oxo-1,4-dihydroquinazolin-3-yl)-4-methylpentanoate?
The IUPAC name of methyl 2-(6-fluoro-2-oxo-1,4-dihydroquinazolin-3-yl)-4-methylpentanoate (CID 171497217) is methyl 2-(6-fluoro-2-oxo-1,4-dihydroquinazolin-3-yl)-4-methylpentanoate.
What is the SMILES notation for methyl 2-(6-fluoro-2-oxo-1,4-dihydroquinazolin-3-yl)-4-methylpentanoate?
The canonical SMILES for methyl 2-(6-fluoro-2-oxo-1,4-dihydroquinazolin-3-yl)-4-methylpentanoate is COC(=O)C(CC(C)C)N1Cc2cc(F)ccc2NC1=O.
What is the InChIKey of methyl 2-(6-fluoro-2-oxo-1,4-dihydroquinazolin-3-yl)-4-methylpentanoate?
The InChIKey is IYNGGWUIAQMVQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19FN2O3/c1-9(2)6-13(14(19)21-3)18-8-10-7-11(16)4-5-12(10)17-15(18)20/h4-5,7,9,13H,6,8H2,1-3H3,(H,17,20).
What are the key properties of methyl 2-(6-fluoro-2-oxo-1,4-dihydroquinazolin-3-yl)-4-methylpentanoate?
methyl 2-(6-fluoro-2-oxo-1,4-dihydroquinazolin-3-yl)-4-methylpentanoate has a molecular weight of 294.33 g/mol, XLogP of 2.76, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(6-fluoro-2-oxo-1,4-dihydroquinazolin-3-yl)-4-methylpentanoate is sourced from PubChem (CID 171497217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).