C26H28N2O4 — CID 17149792
2-[(3-butan-2-yloxybenzoyl)amino]-N-(4-ethoxyphenyl)benzamide (PubChem CID 17149792) has the molecular formula C26H28N2O4 and a molecular weight of 432.52 g/mol. Its IUPAC name is 2-[(3-butan-2-yloxybenzoyl)amino]-N-(4-ethoxyphenyl)benzamide.
| Compound Name | 2-[(3-butan-2-yloxybenzoyl)amino]-N-(4-ethoxyphenyl)benzamide |
|---|---|
| PubChem CID | 17149792 |
| Molecular Formula | C26H28N2O4 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | 2-[(3-butan-2-yloxybenzoyl)amino]-N-(4-ethoxyphenyl)benzamide |
| SMILES | CCOc1ccc(NC(=O)c2ccccc2NC(=O)c2cccc(OC(C)CC)c2)cc1 |
| InChI | InChI=1S/C26H28N2O4/c1-4-18(3)32-22-10-8-9-19(17-22)25(29)28-24-12-7-6-11-23(24)26(30)27-20-13-15-21(16-14-20)31-5-2/h6-18H,4-5H2,1-3H3,(H,27,30)(H,28,29) |
| InChIKey | DKURAZBVLDYDGN-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |