C30H37Cl2N3O2Si — CID 171498895
2-[tert-butyl(diphenyl)silyl]oxy-N-[[1-[(2,6-dichloro-4-pyridinyl)methyl]piperidin-4-yl]methyl]acetamide (PubChem CID 171498895) has the molecular formula C30H37Cl2N3O2Si and a molecular weight of 570.64 g/mol. Its IUPAC name is 2-[tert-butyl(diphenyl)silyl]oxy-N-[[1-[(2,6-dichloro-4-pyridinyl)methyl]piperidin-4-yl]methyl]acetamide.
| Compound Name | 2-[tert-butyl(diphenyl)silyl]oxy-N-[[1-[(2,6-dichloro-4-pyridinyl)methyl]piperidin-4-yl]methyl]acetamide |
|---|---|
| PubChem CID | 171498895 |
| Molecular Formula | C30H37Cl2N3O2Si |
| Molecular Weight | 570.64 g/mol |
| Exact Mass | 569.20 |
| IUPAC Name | 2-[tert-butyl(diphenyl)silyl]oxy-N-[[1-[(2,6-dichloro-4-pyridinyl)methyl]piperidin-4-yl]methyl]acetamide |
| SMILES | CC(C)(C)[Si](OCC(=O)NCC1CCN(Cc2cc(Cl)nc(Cl)c2)CC1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H37Cl2N3O2Si/c1-30(2,3)38(25-10-6-4-7-11-25,26-12-8-5-9-13-26)37-22-29(36)33-20-23-14-16-35(17-15-23)21-24-18-27(31)34-28(32)19-24/h4-13,18-19,23H,14-17,20-22H2,1-3H3,(H,33,36) |
| InChIKey | VWEUNJAIKRRNRT-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.64 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|