C19H22Cl2N2O5S — CID 171499228
[(3S,5R)-5-(2,6-dichloro-4-pyridinyl)-4-[(4-methoxyphenyl)methyl]morpholin-3-yl]methyl methanesulfonate (PubChem CID 171499228) has the molecular formula C19H22Cl2N2O5S and a molecular weight of 461.37 g/mol. Its IUPAC name is [(3S,5R)-5-(2,6-dichloro-4-pyridinyl)-4-[(4-methoxyphenyl)methyl]morpholin-3-yl]methyl methanesulfonate.
| Compound Name | [(3S,5R)-5-(2,6-dichloro-4-pyridinyl)-4-[(4-methoxyphenyl)methyl]morpholin-3-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 171499228 |
| Molecular Formula | C19H22Cl2N2O5S |
| Molecular Weight | 461.37 g/mol |
| Exact Mass | 460.06 |
| IUPAC Name | [(3S,5R)-5-(2,6-dichloro-4-pyridinyl)-4-[(4-methoxyphenyl)methyl]morpholin-3-yl]methyl methanesulfonate |
| SMILES | COc1ccc(CN2[C@H](COS(C)(=O)=O)COC[C@H]2c2cc(Cl)nc(Cl)c2)cc1 |
| InChI | InChI=1S/C19H22Cl2N2O5S/c1-26-16-5-3-13(4-6-16)9-23-15(11-28-29(2,24)25)10-27-12-17(23)14-7-18(20)22-19(21)8-14/h3-8,15,17H,9-12H2,1-2H3/t15-,17-/m0/s1 |
| InChIKey | DZZDOAOXHXZWEW-RDJZCZTQSA-N |
| XLogP | 3.32 |
| TPSA | 77.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.37 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|