About [(3R,5R)-5-(2,6-dichloro-4-pyridinyl)-4-[(4-methoxyphenyl)methyl]morpholin-3-yl]methanol
[(3R,5R)-5-(2,6-dichloro-4-pyridinyl)-4-[(4-methoxyphenyl)methyl]morpholin-3-yl]methanol (PubChem CID 171499758) has the molecular formula C18H20Cl2N2O3
and a molecular weight of 383.28 g/mol. Its IUPAC name is [(3R,5R)-5-(2,6-dichloro-4-pyridinyl)-4-[(4-methoxyphenyl)methyl]morpholin-3-yl]methanol.
Molecular Properties
| Compound Name | [(3R,5R)-5-(2,6-dichloro-4-pyridinyl)-4-[(4-methoxyphenyl)methyl]morpholin-3-yl]methanol |
| PubChem CID | 171499758 |
| Molecular Formula | C18H20Cl2N2O3 |
| Molecular Weight | 383.28 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | [(3R,5R)-5-(2,6-dichloro-4-pyridinyl)-4-[(4-methoxyphenyl)methyl]morpholin-3-yl]methanol |
| SMILES | COc1ccc(CN2[C@H](CO)COC[C@H]2c2cc(Cl)nc(Cl)c2)cc1 |
| InChI | InChI=1S/C18H20Cl2N2O3/c1-24-15-4-2-12(3-5-15)8-22-14(9-23)10-25-11-16(22)13-6-17(19)21-18(20)7-13/h2-7,14,16,23H,8-11H2,1H3/t14-,16+/m1/s1 |
| InChIKey | ZVGZEKGLGAPAHG-ZBFHGGJFSA-N |
| XLogP | 3.33 |
| TPSA | 54.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.28 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze [(3R,5R)-5-(2,6-dichloro-4-pyridinyl)-4-[(4-methoxyphenyl)methyl]morpholin-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R,5R)-5-(2,6-dichloro-4-pyridinyl)-4-[(4-methoxyphenyl)methyl]morpholin-3-yl]methanol?
The IUPAC name of [(3R,5R)-5-(2,6-dichloro-4-pyridinyl)-4-[(4-methoxyphenyl)methyl]morpholin-3-yl]methanol (CID 171499758) is [(3R,5R)-5-(2,6-dichloro-4-pyridinyl)-4-[(4-methoxyphenyl)methyl]morpholin-3-yl]methanol.
What is the SMILES notation for [(3R,5R)-5-(2,6-dichloro-4-pyridinyl)-4-[(4-methoxyphenyl)methyl]morpholin-3-yl]methanol?
The canonical SMILES for [(3R,5R)-5-(2,6-dichloro-4-pyridinyl)-4-[(4-methoxyphenyl)methyl]morpholin-3-yl]methanol is COc1ccc(CN2[C@H](CO)COC[C@H]2c2cc(Cl)nc(Cl)c2)cc1.
What is the InChIKey of [(3R,5R)-5-(2,6-dichloro-4-pyridinyl)-4-[(4-methoxyphenyl)methyl]morpholin-3-yl]methanol?
The InChIKey is ZVGZEKGLGAPAHG-ZBFHGGJFSA-N. The full InChI is InChI=1S/C18H20Cl2N2O3/c1-24-15-4-2-12(3-5-15)8-22-14(9-23)10-25-11-16(22)13-6-17(19)21-18(20)7-13/h2-7,14,16,23H,8-11H2,1H3/t14-,16+/m1/s1.
What are the key properties of [(3R,5R)-5-(2,6-dichloro-4-pyridinyl)-4-[(4-methoxyphenyl)methyl]morpholin-3-yl]methanol?
[(3R,5R)-5-(2,6-dichloro-4-pyridinyl)-4-[(4-methoxyphenyl)methyl]morpholin-3-yl]methanol has a molecular weight of 383.28 g/mol, XLogP of 3.33, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R,5R)-5-(2,6-dichloro-4-pyridinyl)-4-[(4-methoxyphenyl)methyl]morpholin-3-yl]methanol is sourced from PubChem (CID 171499758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).