C13H23ClN2 — CID 171500560
N-[(1Z,3Z)-3-chlorohexa-1,3-dienyl]-N,1-dimethylpiperidin-4-amine (PubChem CID 171500560) has the molecular formula C13H23ClN2 and a molecular weight of 242.79 g/mol. Its IUPAC name is N-[(1Z,3Z)-3-chlorohexa-1,3-dienyl]-N,1-dimethylpiperidin-4-amine.
| Compound Name | N-[(1Z,3Z)-3-chlorohexa-1,3-dienyl]-N,1-dimethylpiperidin-4-amine |
|---|---|
| PubChem CID | 171500560 |
| Molecular Formula | C13H23ClN2 |
| Molecular Weight | 242.79 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | N-[(1Z,3Z)-3-chlorohexa-1,3-dienyl]-N,1-dimethylpiperidin-4-amine |
| SMILES | CC/C=C(Cl)/C=C\N(C)C1CCN(C)CC1 |
| InChI | InChI=1S/C13H23ClN2/c1-4-5-12(14)6-11-16(3)13-7-9-15(2)10-8-13/h5-6,11,13H,4,7-10H2,1-3H3/b11-6-,12-5- |
| InChIKey | ROJDJKMMRXLDLS-ODASSNHZSA-N |
| XLogP | 3.06 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.79 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|