About propan-2-yl formate;1-pyrimidin-2-ylpropan-2-one
propan-2-yl formate;1-pyrimidin-2-ylpropan-2-one (PubChem CID 171501049) has the molecular formula C11H16N2O3
and a molecular weight of 224.26 g/mol. Its IUPAC name is propan-2-yl formate;1-pyrimidin-2-ylpropan-2-one.
Molecular Properties
| Compound Name | propan-2-yl formate;1-pyrimidin-2-ylpropan-2-one |
| PubChem CID | 171501049 |
| Molecular Formula | C11H16N2O3 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | propan-2-yl formate;1-pyrimidin-2-ylpropan-2-one |
| SMILES | CC(=O)Cc1ncccn1.CC(C)OC=O |
| InChI | InChI=1S/C7H8N2O.C4H8O2/c1-6(10)5-7-8-3-2-4-9-7;1-4(2)6-3-5/h2-4H,5H2,1H3;3-4H,1-2H3 |
| InChIKey | SOLVNFJXSJVXLI-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 69.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze propan-2-yl formate;1-pyrimidin-2-ylpropan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl formate;1-pyrimidin-2-ylpropan-2-one?
The IUPAC name of propan-2-yl formate;1-pyrimidin-2-ylpropan-2-one (CID 171501049) is propan-2-yl formate;1-pyrimidin-2-ylpropan-2-one.
What is the SMILES notation for propan-2-yl formate;1-pyrimidin-2-ylpropan-2-one?
The canonical SMILES for propan-2-yl formate;1-pyrimidin-2-ylpropan-2-one is CC(=O)Cc1ncccn1.CC(C)OC=O.
What is the InChIKey of propan-2-yl formate;1-pyrimidin-2-ylpropan-2-one?
The InChIKey is SOLVNFJXSJVXLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O.C4H8O2/c1-6(10)5-7-8-3-2-4-9-7;1-4(2)6-3-5/h2-4H,5H2,1H3;3-4H,1-2H3.
What are the key properties of propan-2-yl formate;1-pyrimidin-2-ylpropan-2-one?
propan-2-yl formate;1-pyrimidin-2-ylpropan-2-one has a molecular weight of 224.26 g/mol, XLogP of 1.18, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl formate;1-pyrimidin-2-ylpropan-2-one is sourced from PubChem (CID 171501049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).