About 4-oxo-6,7-dihydro-5H-pyrazolo[5,1-b][1,3]thiazin-3-amine
4-oxo-6,7-dihydro-5H-pyrazolo[5,1-b][1,3]thiazin-3-amine (PubChem CID 171501257) has the molecular formula C6H9N3OS
and a molecular weight of 171.22 g/mol. Its IUPAC name is 4-oxo-6,7-dihydro-5H-pyrazolo[5,1-b][1,3]thiazin-3-amine.
Molecular Properties
| Compound Name | 4-oxo-6,7-dihydro-5H-pyrazolo[5,1-b][1,3]thiazin-3-amine |
| PubChem CID | 171501257 |
| Molecular Formula | C6H9N3OS |
| Molecular Weight | 171.22 g/mol |
| Exact Mass | 171.05 |
| IUPAC Name | 4-oxo-6,7-dihydro-5H-pyrazolo[5,1-b][1,3]thiazin-3-amine |
| SMILES | Nc1cnn2c1S(=O)CCC2 |
| InChI | InChI=1S/C6H9N3OS/c7-5-4-8-9-2-1-3-11(10)6(5)9/h4H,1-3,7H2 |
| InChIKey | UUIWVEGBHLCAFX-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.22 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-oxo-6,7-dihydro-5H-pyrazolo[5,1-b][1,3]thiazin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-oxo-6,7-dihydro-5H-pyrazolo[5,1-b][1,3]thiazin-3-amine?
The IUPAC name of 4-oxo-6,7-dihydro-5H-pyrazolo[5,1-b][1,3]thiazin-3-amine (CID 171501257) is 4-oxo-6,7-dihydro-5H-pyrazolo[5,1-b][1,3]thiazin-3-amine.
What is the SMILES notation for 4-oxo-6,7-dihydro-5H-pyrazolo[5,1-b][1,3]thiazin-3-amine?
The canonical SMILES for 4-oxo-6,7-dihydro-5H-pyrazolo[5,1-b][1,3]thiazin-3-amine is Nc1cnn2c1S(=O)CCC2.
What is the InChIKey of 4-oxo-6,7-dihydro-5H-pyrazolo[5,1-b][1,3]thiazin-3-amine?
The InChIKey is UUIWVEGBHLCAFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N3OS/c7-5-4-8-9-2-1-3-11(10)6(5)9/h4H,1-3,7H2.
What are the key properties of 4-oxo-6,7-dihydro-5H-pyrazolo[5,1-b][1,3]thiazin-3-amine?
4-oxo-6,7-dihydro-5H-pyrazolo[5,1-b][1,3]thiazin-3-amine has a molecular weight of 171.22 g/mol, XLogP of -0.02, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxo-6,7-dihydro-5H-pyrazolo[5,1-b][1,3]thiazin-3-amine is sourced from PubChem (CID 171501257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).