C24H25N5O3 — CID 171501406
(E)-2-amino-4-methylimino-3-[(2-methylquinolin-7-yl)methyl-(3-pyridin-2-ylpropanoyl)amino]but-2-enoic acid (PubChem CID 171501406) has the molecular formula C24H25N5O3 and a molecular weight of 431.50 g/mol. Its IUPAC name is (E)-2-amino-4-methylimino-3-[(2-methylquinolin-7-yl)methyl-(3-pyridin-2-ylpropanoyl)amino]but-2-enoic acid.
| Compound Name | (E)-2-amino-4-methylimino-3-[(2-methylquinolin-7-yl)methyl-(3-pyridin-2-ylpropanoyl)amino]but-2-enoic acid |
|---|---|
| PubChem CID | 171501406 |
| Molecular Formula | C24H25N5O3 |
| Molecular Weight | 431.50 g/mol |
| Exact Mass | 431.20 |
| IUPAC Name | (E)-2-amino-4-methylimino-3-[(2-methylquinolin-7-yl)methyl-(3-pyridin-2-ylpropanoyl)amino]but-2-enoic acid |
| SMILES | C/N=C/C(=C(\N)C(=O)O)N(Cc1ccc2ccc(C)nc2c1)C(=O)CCc1ccccn1 |
| InChI | InChI=1S/C24H25N5O3/c1-16-6-8-18-9-7-17(13-20(18)28-16)15-29(21(14-26-2)23(25)24(31)32)22(30)11-10-19-5-3-4-12-27-19/h3-9,12-14H,10-11,15,25H2,1-2H3,(H,31,32)/b23-21+,26-14+ |
| InChIKey | WXRWJMOOJUXZSV-QDABFYFFSA-N |
| XLogP | 2.86 |
| TPSA | 121.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.50 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|