About ethane;4-fluoro-2,3-dihydro-1-benzothiophene 1-oxide;1-methylbenzimidazole
ethane;4-fluoro-2,3-dihydro-1-benzothiophene 1-oxide;1-methylbenzimidazole (PubChem CID 171501747) has the molecular formula C18H21FN2OS
and a molecular weight of 332.44 g/mol. Its IUPAC name is ethane;4-fluoro-2,3-dihydro-1-benzothiophene 1-oxide;1-methylbenzimidazole.
Molecular Properties
| Compound Name | ethane;4-fluoro-2,3-dihydro-1-benzothiophene 1-oxide;1-methylbenzimidazole |
| PubChem CID | 171501747 |
| Molecular Formula | C18H21FN2OS |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | ethane;4-fluoro-2,3-dihydro-1-benzothiophene 1-oxide;1-methylbenzimidazole |
| SMILES | CC.Cn1cnc2ccccc21.O=S1CCc2c(F)cccc21 |
| InChI | InChI=1S/C8H7FOS.C8H8N2.C2H6/c9-7-2-1-3-8-6(7)4-5-11(8)10;1-10-6-9-7-4-2-3-5-8(7)10;1-2/h1-3H,4-5H2;2-6H,1H3;1-2H3 |
| InChIKey | UZQNWEXKPKFAQM-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;4-fluoro-2,3-dihydro-1-benzothiophene 1-oxide;1-methylbenzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-fluoro-2,3-dihydro-1-benzothiophene 1-oxide;1-methylbenzimidazole?
The IUPAC name of ethane;4-fluoro-2,3-dihydro-1-benzothiophene 1-oxide;1-methylbenzimidazole (CID 171501747) is ethane;4-fluoro-2,3-dihydro-1-benzothiophene 1-oxide;1-methylbenzimidazole.
What is the SMILES notation for ethane;4-fluoro-2,3-dihydro-1-benzothiophene 1-oxide;1-methylbenzimidazole?
The canonical SMILES for ethane;4-fluoro-2,3-dihydro-1-benzothiophene 1-oxide;1-methylbenzimidazole is CC.Cn1cnc2ccccc21.O=S1CCc2c(F)cccc21.
What is the InChIKey of ethane;4-fluoro-2,3-dihydro-1-benzothiophene 1-oxide;1-methylbenzimidazole?
The InChIKey is UZQNWEXKPKFAQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7FOS.C8H8N2.C2H6/c9-7-2-1-3-8-6(7)4-5-11(8)10;1-10-6-9-7-4-2-3-5-8(7)10;1-2/h1-3H,4-5H2;2-6H,1H3;1-2H3.
What are the key properties of ethane;4-fluoro-2,3-dihydro-1-benzothiophene 1-oxide;1-methylbenzimidazole?
ethane;4-fluoro-2,3-dihydro-1-benzothiophene 1-oxide;1-methylbenzimidazole has a molecular weight of 332.44 g/mol, XLogP of 4.09, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-fluoro-2,3-dihydro-1-benzothiophene 1-oxide;1-methylbenzimidazole is sourced from PubChem (CID 171501747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).