C24H37F3N4O5 — CID 171502484
(2S,3R)-N-[1-cyclopropyl-4-(methylamino)-3,4-dioxobutan-2-yl]-1-[(2S)-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-3-propan-2-ylpyrrolidine-2-carboxamide (PubChem CID 171502484) has the molecular formula C24H37F3N4O5 and a molecular weight of 518.58 g/mol. Its IUPAC name is (2S,3R)-N-[1-cyclopropyl-4-(methylamino)-3,4-dioxobutan-2-yl]-1-[(2S)-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-3-propan-2-ylpyrrolidine-2-carboxamide.
| Compound Name | (2S,3R)-N-[1-cyclopropyl-4-(methylamino)-3,4-dioxobutan-2-yl]-1-[(2S)-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-3-propan-2-ylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 171502484 |
| Molecular Formula | C24H37F3N4O5 |
| Molecular Weight | 518.58 g/mol |
| Exact Mass | 518.27 |
| IUPAC Name | (2S,3R)-N-[1-cyclopropyl-4-(methylamino)-3,4-dioxobutan-2-yl]-1-[(2S)-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-3-propan-2-ylpyrrolidine-2-carboxamide |
| SMILES | CNC(=O)C(=O)C(CC1CC1)NC(=O)[C@@H]1[C@@H](C(C)C)CCN1C(=O)[C@@H](NC(=O)C(F)(F)F)C(C)(C)C |
| InChI | InChI=1S/C24H37F3N4O5/c1-12(2)14-9-10-31(21(35)18(23(3,4)5)30-22(36)24(25,26)27)16(14)19(33)29-15(11-13-7-8-13)17(32)20(34)28-6/h12-16,18H,7-11H2,1-6H3,(H,28,34)(H,29,33)(H,30,36)/t14-,15?,16+,18-/m1/s1 |
| InChIKey | HGXHISRPKHXOER-OJISTFMOSA-N |
| XLogP | 1.55 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.58 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|